C31H61FN8O — CID 123399698
2-[amino(dimethylamino)methyl]-3-[2-(2-cyanopropan-2-yl)nonyl-methylamino]-N-[5-fluoro-4-(4-methylpiperazin-1-yl)piperidin-3-yl]butanamide (PubChem CID 123399698) has the molecular formula C31H61FN8O and a molecular weight of 580.88 g/mol. Its IUPAC name is 2-[amino(dimethylamino)methyl]-3-[2-(2-cyanopropan-2-yl)nonyl-methylamino]-N-[5-fluoro-4-(4-methylpiperazin-1-yl)piperidin-3-yl]butanamide.
| Compound Name | 2-[amino(dimethylamino)methyl]-3-[2-(2-cyanopropan-2-yl)nonyl-methylamino]-N-[5-fluoro-4-(4-methylpiperazin-1-yl)piperidin-3-yl]butanamide |
|---|---|
| PubChem CID | 123399698 |
| Molecular Formula | C31H61FN8O |
| Molecular Weight | 580.88 g/mol |
| Exact Mass | 580.50 |
| IUPAC Name | 2-[amino(dimethylamino)methyl]-3-[2-(2-cyanopropan-2-yl)nonyl-methylamino]-N-[5-fluoro-4-(4-methylpiperazin-1-yl)piperidin-3-yl]butanamide |
| SMILES | CCCCCCCC(CN(C)C(C)C(C(=O)NC1CNCC(F)C1N1CCN(C)CC1)C(N)N(C)C)C(C)(C)C#N |
| InChI | InChI=1S/C31H61FN8O/c1-9-10-11-12-13-14-24(31(3,4)22-33)21-39(8)23(2)27(29(34)37(5)6)30(41)36-26-20-35-19-25(32)28(26)40-17-15-38(7)16-18-40/h23-29,35H,9-21,34H2,1-8H3,(H,36,41) |
| InChIKey | IZTSXYASNPSYEZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 103.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.88 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|