C25H39B2NO4 — CID 123399944
1'-methyl-4,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,3'-pyrrolidine] (PubChem CID 123399944) has the molecular formula C25H39B2NO4 and a molecular weight of 439.21 g/mol. Its IUPAC name is 1'-methyl-4,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,3'-pyrrolidine].
| Compound Name | 1'-methyl-4,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,3'-pyrrolidine] |
|---|---|
| PubChem CID | 123399944 |
| Molecular Formula | C25H39B2NO4 |
| Molecular Weight | 439.21 g/mol |
| Exact Mass | 439.31 |
| IUPAC Name | 1'-methyl-4,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,3'-pyrrolidine] |
| SMILES | CN1CCC2(CCc3c(B4OC(C)(C)C(C)(C)O4)ccc(B4OC(C)(C)C(C)(C)O4)c32)C1 |
| InChI | InChI=1S/C25H39B2NO4/c1-21(2)22(3,4)30-26(29-21)18-10-11-19(27-31-23(5,6)24(7,8)32-27)20-17(18)12-13-25(20)14-15-28(9)16-25/h10-11H,12-16H2,1-9H3 |
| InChIKey | JSAJLOCGTTZAJC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.21 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|