C72H118O13Si2 — CID 123400300
bis[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]silyloxy-bis[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]silane (PubChem CID 123400300) has the molecular formula C72H118O13Si2 and a molecular weight of 1247.89 g/mol. Its IUPAC name is bis[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]silyloxy-bis[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]silane.
| Compound Name | bis[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]silyloxy-bis[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]silane |
|---|---|
| PubChem CID | 123400300 |
| Molecular Formula | C72H118O13Si2 |
| Molecular Weight | 1247.89 g/mol |
| Exact Mass | 1246.81 |
| IUPAC Name | bis[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]silyloxy-bis[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]silane |
| SMILES | CC(C)(C)Oc1cc(OC(C)(C)C)c([SiH](O[SiH](c2c(OC(C)(C)C)cc(OC(C)(C)C)cc2OC(C)(C)C)c2c(OC(C)(C)C)cc(OC(C)(C)C)cc2OC(C)(C)C)c2c(OC(C)(C)C)cc(OC(C)(C)C)cc2OC(C)(C)C)c(OC(C)(C)C)c1 |
| InChI | InChI=1S/C72H118O13Si2/c1-61(2,3)73-45-37-49(77-65(13,14)15)57(50(38-45)78-66(16,17)18)86(58-51(79-67(19,20)21)39-46(74-62(4,5)6)40-52(58)80-68(22,23)24)85-87(59-53(81-69(25,26)27)41-47(75-63(7,8)9)42-54(59)82-70(28,29)30)60-55(83-71(31,32)33)43-48(76-64(10,11)12)44-56(60)84-72(34,35)36/h37-44,86-87H,1-36H3 |
| InChIKey | YUMRUCFDUXIQRU-UHFFFAOYSA-N |
| XLogP | 16.21 |
| TPSA | 119.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 87 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1247.89 |
| LogP ≤ 5 | 16.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|