C12H3F14I — CID 123400315
1-iodo-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-5-(1,1,2,2,2-pentafluoroethyl)benzene (PubChem CID 123400315) has the molecular formula C12H3F14I and a molecular weight of 540.03 g/mol. Its IUPAC name is 1-iodo-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-5-(1,1,2,2,2-pentafluoroethyl)benzene.
| Compound Name | 1-iodo-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-5-(1,1,2,2,2-pentafluoroethyl)benzene |
|---|---|
| PubChem CID | 123400315 |
| Molecular Formula | C12H3F14I |
| Molecular Weight | 540.03 g/mol |
| Exact Mass | 539.91 |
| IUPAC Name | 1-iodo-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-5-(1,1,2,2,2-pentafluoroethyl)benzene |
| SMILES | FC(F)(F)C(F)(F)c1cc(I)cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H3F14I/c13-7(10(18,19)20,9(16,17)12(24,25)26)4-1-5(3-6(27)2-4)8(14,15)11(21,22)23/h1-3H |
| InChIKey | ZWLSARDDWYOYFD-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.03 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|