About 2-aminoethylideneurea
2-aminoethylideneurea (PubChem CID 123400317) has the molecular formula C3H7N3O
and a molecular weight of 101.11 g/mol. Its IUPAC name is 2-aminoethylideneurea.
Molecular Properties
| Compound Name | 2-aminoethylideneurea |
| PubChem CID | 123400317 |
| Molecular Formula | C3H7N3O |
| Molecular Weight | 101.11 g/mol |
| Exact Mass | 101.06 |
| IUPAC Name | 2-aminoethylideneurea |
| SMILES | NCC=NC(N)=O |
| InChI | InChI=1S/C3H7N3O/c4-1-2-6-3(5)7/h2H,1,4H2,(H2,5,7) |
| InChIKey | LIWJTYLKOVCHDS-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.11 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethylideneurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethylideneurea?
The IUPAC name of 2-aminoethylideneurea (CID 123400317) is 2-aminoethylideneurea.
What is the SMILES notation for 2-aminoethylideneurea?
The canonical SMILES for 2-aminoethylideneurea is NCC=NC(N)=O.
What is the InChIKey of 2-aminoethylideneurea?
The InChIKey is LIWJTYLKOVCHDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7N3O/c4-1-2-6-3(5)7/h2H,1,4H2,(H2,5,7).
What are the key properties of 2-aminoethylideneurea?
2-aminoethylideneurea has a molecular weight of 101.11 g/mol, XLogP of -0.91, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethylideneurea is sourced from PubChem (CID 123400317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).