C61H104NO9P — CID 123400374
[(2R)-3-[2-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-octadec-9-enoyloxypropyl] octadec-9-enoate (PubChem CID 123400374) has the molecular formula C61H104NO9P and a molecular weight of 1026.47 g/mol. Its IUPAC name is [(2R)-3-[2-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-octadec-9-enoyloxypropyl] octadec-9-enoate.
| Compound Name | [(2R)-3-[2-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-octadec-9-enoyloxypropyl] octadec-9-enoate |
|---|---|
| PubChem CID | 123400374 |
| Molecular Formula | C61H104NO9P |
| Molecular Weight | 1026.47 g/mol |
| Exact Mass | 1025.74 |
| IUPAC Name | [(2R)-3-[2-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-octadec-9-enoyloxypropyl] octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCNC(=O)C=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C)OC(=O)CCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C61H104NO9P/c1-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-43-59(64)68-51-56(71-60(65)44-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-2)52-70-72(66,67)69-49-48-62-58(63)50-54(4)41-38-40-53(3)45-46-57-55(5)42-39-47-61(57,6)7/h22-25,38,40-41,45-46,50,56H,8-21,26-37,39,42-44,47-49,51-52H2,1-7H3,(H,62,63)(H,66,67)/t56-/m1/s1 |
| InChIKey | FHEIBIAYAPKVOY-LXXIDKMWSA-N |
| XLogP | 17.30 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1026.47 |
| LogP ≤ 5 | 17.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|