C25H33FN3O+ — CID 123400474
4-[7-[(4-fluoro-4-prop-2-enylcyclohexyl)methyl]-1-methyl-6,7-dihydro-5H-cyclohepta[b]pyridin-1-ium-3-yl]-5-methyl-1,2-oxazol-3-amine (PubChem CID 123400474) has the molecular formula C25H33FN3O+ and a molecular weight of 410.56 g/mol. Its IUPAC name is 4-[7-[(4-fluoro-4-prop-2-enylcyclohexyl)methyl]-1-methyl-6,7-dihydro-5H-cyclohepta[b]pyridin-1-ium-3-yl]-5-methyl-1,2-oxazol-3-amine.
| Compound Name | 4-[7-[(4-fluoro-4-prop-2-enylcyclohexyl)methyl]-1-methyl-6,7-dihydro-5H-cyclohepta[b]pyridin-1-ium-3-yl]-5-methyl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 123400474 |
| Molecular Formula | C25H33FN3O+ |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | 4-[7-[(4-fluoro-4-prop-2-enylcyclohexyl)methyl]-1-methyl-6,7-dihydro-5H-cyclohepta[b]pyridin-1-ium-3-yl]-5-methyl-1,2-oxazol-3-amine |
| SMILES | C=CCC1(F)CCC(CC2C=Cc3c(cc(-c4c(N)noc4C)c[n+]3C)CC2)CC1 |
| InChI | InChI=1S/C25H33FN3O/c1-4-11-25(26)12-9-19(10-13-25)14-18-5-7-20-15-21(16-29(3)22(20)8-6-18)23-17(2)30-28-24(23)27/h4,6,8,15-16,18-19H,1,5,7,9-14H2,2-3H3,(H2,27,28)/q+1 |
| InChIKey | CWSNBLMEBWNXHY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 55.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|