About 2,5-diazabicyclo[2.1.1]hexa-1,4(6)-diene
2,5-diazabicyclo[2.1.1]hexa-1,4(6)-diene (PubChem CID 123400656) has the molecular formula C4H4N2
and a molecular weight of 80.09 g/mol. Its IUPAC name is 2,5-diazabicyclo[2.1.1]hexa-1,4(6)-diene.
Molecular Properties
| Compound Name | 2,5-diazabicyclo[2.1.1]hexa-1,4(6)-diene |
| PubChem CID | 123400656 |
| Molecular Formula | C4H4N2 |
| Molecular Weight | 80.09 g/mol |
| Exact Mass | 80.04 |
| IUPAC Name | 2,5-diazabicyclo[2.1.1]hexa-1,4(6)-diene |
| SMILES | C1=C2CN=C1N2 |
| InChI | InChI=1S/C4H4N2/c1-3-2-5-4(1)6-3/h1H,2H2,(H,5,6) |
| InChIKey | IIIKPJWMRQKWDZ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 80.09 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-diazabicyclo[2.1.1]hexa-1,4(6)-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diazabicyclo[2.1.1]hexa-1,4(6)-diene?
The IUPAC name of 2,5-diazabicyclo[2.1.1]hexa-1,4(6)-diene (CID 123400656) is 2,5-diazabicyclo[2.1.1]hexa-1,4(6)-diene.
What is the SMILES notation for 2,5-diazabicyclo[2.1.1]hexa-1,4(6)-diene?
The canonical SMILES for 2,5-diazabicyclo[2.1.1]hexa-1,4(6)-diene is C1=C2CN=C1N2.
What is the InChIKey of 2,5-diazabicyclo[2.1.1]hexa-1,4(6)-diene?
The InChIKey is IIIKPJWMRQKWDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2/c1-3-2-5-4(1)6-3/h1H,2H2,(H,5,6).
What are the key properties of 2,5-diazabicyclo[2.1.1]hexa-1,4(6)-diene?
2,5-diazabicyclo[2.1.1]hexa-1,4(6)-diene has a molecular weight of 80.09 g/mol, XLogP of -0.11, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diazabicyclo[2.1.1]hexa-1,4(6)-diene is sourced from PubChem (CID 123400656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).