About (3S)-4-(4,5-dihydropyrimidin-2-yl)-3-methylmorpholine
(3S)-4-(4,5-dihydropyrimidin-2-yl)-3-methylmorpholine (PubChem CID 123400735) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is (3S)-4-(4,5-dihydropyrimidin-2-yl)-3-methylmorpholine.
Molecular Properties
| Compound Name | (3S)-4-(4,5-dihydropyrimidin-2-yl)-3-methylmorpholine |
| PubChem CID | 123400735 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | (3S)-4-(4,5-dihydropyrimidin-2-yl)-3-methylmorpholine |
| SMILES | C[C@H]1COCCN1C1=NCCC=N1 |
| InChI | InChI=1S/C9H15N3O/c1-8-7-13-6-5-12(8)9-10-3-2-4-11-9/h3,8H,2,4-7H2,1H3/t8-/m0/s1 |
| InChIKey | OZHJCGASBPTYLQ-QMMMGPOBSA-N |
| XLogP | 0.54 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S)-4-(4,5-dihydropyrimidin-2-yl)-3-methylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-4-(4,5-dihydropyrimidin-2-yl)-3-methylmorpholine?
The IUPAC name of (3S)-4-(4,5-dihydropyrimidin-2-yl)-3-methylmorpholine (CID 123400735) is (3S)-4-(4,5-dihydropyrimidin-2-yl)-3-methylmorpholine.
What is the SMILES notation for (3S)-4-(4,5-dihydropyrimidin-2-yl)-3-methylmorpholine?
The canonical SMILES for (3S)-4-(4,5-dihydropyrimidin-2-yl)-3-methylmorpholine is C[C@H]1COCCN1C1=NCCC=N1.
What is the InChIKey of (3S)-4-(4,5-dihydropyrimidin-2-yl)-3-methylmorpholine?
The InChIKey is OZHJCGASBPTYLQ-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H15N3O/c1-8-7-13-6-5-12(8)9-10-3-2-4-11-9/h3,8H,2,4-7H2,1H3/t8-/m0/s1.
What are the key properties of (3S)-4-(4,5-dihydropyrimidin-2-yl)-3-methylmorpholine?
(3S)-4-(4,5-dihydropyrimidin-2-yl)-3-methylmorpholine has a molecular weight of 181.24 g/mol, XLogP of 0.54, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-4-(4,5-dihydropyrimidin-2-yl)-3-methylmorpholine is sourced from PubChem (CID 123400735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).