C16H32N2O2S — CID 123400959
3-[ethylamino(sulfanyl)methyl]-4,6-dimethyl-N-(2-methylpropyl)-5-oxoheptanamide (PubChem CID 123400959) has the molecular formula C16H32N2O2S and a molecular weight of 316.51 g/mol. Its IUPAC name is 3-[ethylamino(sulfanyl)methyl]-4,6-dimethyl-N-(2-methylpropyl)-5-oxoheptanamide.
| Compound Name | 3-[ethylamino(sulfanyl)methyl]-4,6-dimethyl-N-(2-methylpropyl)-5-oxoheptanamide |
|---|---|
| PubChem CID | 123400959 |
| Molecular Formula | C16H32N2O2S |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 3-[ethylamino(sulfanyl)methyl]-4,6-dimethyl-N-(2-methylpropyl)-5-oxoheptanamide |
| SMILES | CCNC(S)C(CC(=O)NCC(C)C)C(C)C(=O)C(C)C |
| InChI | InChI=1S/C16H32N2O2S/c1-7-17-16(21)13(12(6)15(20)11(4)5)8-14(19)18-9-10(2)3/h10-13,16-17,21H,7-9H2,1-6H3,(H,18,19) |
| InChIKey | CMDASIRHHHBDRU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|