About 2-[ethyl(dimethyl)-λ4-sulfanyl]-1-methyl-1-pentan-3-ylguanidine
2-[ethyl(dimethyl)-λ4-sulfanyl]-1-methyl-1-pentan-3-ylguanidine (PubChem CID 123401090) has the molecular formula C11H27N3S
and a molecular weight of 233.42 g/mol. Its IUPAC name is 2-[ethyl(dimethyl)-λ4-sulfanyl]-1-methyl-1-pentan-3-ylguanidine.
Molecular Properties
| Compound Name | 2-[ethyl(dimethyl)-λ4-sulfanyl]-1-methyl-1-pentan-3-ylguanidine |
| PubChem CID | 123401090 |
| Molecular Formula | C11H27N3S |
| Molecular Weight | 233.42 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 2-[ethyl(dimethyl)-λ4-sulfanyl]-1-methyl-1-pentan-3-ylguanidine |
| SMILES | CCC(CC)N(C)C(N)=NS(C)(C)CC |
| InChI | InChI=1S/C11H27N3S/c1-7-10(8-2)14(4)11(12)13-15(5,6)9-3/h10H,7-9H2,1-6H3,(H2,12,13) |
| InChIKey | CXQMVIIUQBDGHA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[ethyl(dimethyl)-λ4-sulfanyl]-1-methyl-1-pentan-3-ylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[ethyl(dimethyl)-λ4-sulfanyl]-1-methyl-1-pentan-3-ylguanidine?
The IUPAC name of 2-[ethyl(dimethyl)-λ4-sulfanyl]-1-methyl-1-pentan-3-ylguanidine (CID 123401090) is 2-[ethyl(dimethyl)-λ4-sulfanyl]-1-methyl-1-pentan-3-ylguanidine.
What is the SMILES notation for 2-[ethyl(dimethyl)-λ4-sulfanyl]-1-methyl-1-pentan-3-ylguanidine?
The canonical SMILES for 2-[ethyl(dimethyl)-λ4-sulfanyl]-1-methyl-1-pentan-3-ylguanidine is CCC(CC)N(C)C(N)=NS(C)(C)CC.
What is the InChIKey of 2-[ethyl(dimethyl)-λ4-sulfanyl]-1-methyl-1-pentan-3-ylguanidine?
The InChIKey is CXQMVIIUQBDGHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H27N3S/c1-7-10(8-2)14(4)11(12)13-15(5,6)9-3/h10H,7-9H2,1-6H3,(H2,12,13).
What are the key properties of 2-[ethyl(dimethyl)-λ4-sulfanyl]-1-methyl-1-pentan-3-ylguanidine?
2-[ethyl(dimethyl)-λ4-sulfanyl]-1-methyl-1-pentan-3-ylguanidine has a molecular weight of 233.42 g/mol, XLogP of 2.42, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethyl(dimethyl)-λ4-sulfanyl]-1-methyl-1-pentan-3-ylguanidine is sourced from PubChem (CID 123401090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).