About [3-hydroxy-4-(4-methylpiperazin-1-yl)butan-2-yl] 2-tert-butyl-2,4,4-trimethylhexanoate
[3-hydroxy-4-(4-methylpiperazin-1-yl)butan-2-yl] 2-tert-butyl-2,4,4-trimethylhexanoate (PubChem CID 123401306) has the molecular formula C22H44N2O3
and a molecular weight of 384.61 g/mol. Its IUPAC name is [3-hydroxy-4-(4-methylpiperazin-1-yl)butan-2-yl] 2-tert-butyl-2,4,4-trimethylhexanoate.
Molecular Properties
| Compound Name | [3-hydroxy-4-(4-methylpiperazin-1-yl)butan-2-yl] 2-tert-butyl-2,4,4-trimethylhexanoate |
| PubChem CID | 123401306 |
| Molecular Formula | C22H44N2O3 |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 384.34 |
| IUPAC Name | [3-hydroxy-4-(4-methylpiperazin-1-yl)butan-2-yl] 2-tert-butyl-2,4,4-trimethylhexanoate |
| SMILES | CCC(C)(C)CC(C)(C(=O)OC(C)C(O)CN1CCN(C)CC1)C(C)(C)C |
| InChI | InChI=1S/C22H44N2O3/c1-10-21(6,7)16-22(8,20(3,4)5)19(26)27-17(2)18(25)15-24-13-11-23(9)12-14-24/h17-18,25H,10-16H2,1-9H3 |
| InChIKey | AWFHHQWWCJENAW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-hydroxy-4-(4-methylpiperazin-1-yl)butan-2-yl] 2-tert-butyl-2,4,4-trimethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-hydroxy-4-(4-methylpiperazin-1-yl)butan-2-yl] 2-tert-butyl-2,4,4-trimethylhexanoate?
The IUPAC name of [3-hydroxy-4-(4-methylpiperazin-1-yl)butan-2-yl] 2-tert-butyl-2,4,4-trimethylhexanoate (CID 123401306) is [3-hydroxy-4-(4-methylpiperazin-1-yl)butan-2-yl] 2-tert-butyl-2,4,4-trimethylhexanoate.
What is the SMILES notation for [3-hydroxy-4-(4-methylpiperazin-1-yl)butan-2-yl] 2-tert-butyl-2,4,4-trimethylhexanoate?
The canonical SMILES for [3-hydroxy-4-(4-methylpiperazin-1-yl)butan-2-yl] 2-tert-butyl-2,4,4-trimethylhexanoate is CCC(C)(C)CC(C)(C(=O)OC(C)C(O)CN1CCN(C)CC1)C(C)(C)C.
What is the InChIKey of [3-hydroxy-4-(4-methylpiperazin-1-yl)butan-2-yl] 2-tert-butyl-2,4,4-trimethylhexanoate?
The InChIKey is AWFHHQWWCJENAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44N2O3/c1-10-21(6,7)16-22(8,20(3,4)5)19(26)27-17(2)18(25)15-24-13-11-23(9)12-14-24/h17-18,25H,10-16H2,1-9H3.
What are the key properties of [3-hydroxy-4-(4-methylpiperazin-1-yl)butan-2-yl] 2-tert-butyl-2,4,4-trimethylhexanoate?
[3-hydroxy-4-(4-methylpiperazin-1-yl)butan-2-yl] 2-tert-butyl-2,4,4-trimethylhexanoate has a molecular weight of 384.61 g/mol, XLogP of 3.41, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-hydroxy-4-(4-methylpiperazin-1-yl)butan-2-yl] 2-tert-butyl-2,4,4-trimethylhexanoate is sourced from PubChem (CID 123401306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).