About 2,4-dihydrothiochromeno[4,3-c]pyrazol-3-yl(morpholin-4-yl)methanone
2,4-dihydrothiochromeno[4,3-c]pyrazol-3-yl(morpholin-4-yl)methanone (PubChem CID 123401361) has the molecular formula C15H15N3O2S
and a molecular weight of 301.37 g/mol. Its IUPAC name is 2,4-dihydrothiochromeno[4,3-c]pyrazol-3-yl(morpholin-4-yl)methanone.
Molecular Properties
| Compound Name | 2,4-dihydrothiochromeno[4,3-c]pyrazol-3-yl(morpholin-4-yl)methanone |
| PubChem CID | 123401361 |
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 2,4-dihydrothiochromeno[4,3-c]pyrazol-3-yl(morpholin-4-yl)methanone |
| SMILES | O=C(c1[nH]nc2c1CSc1ccccc1-2)N1CCOCC1 |
| InChI | InChI=1S/C15H15N3O2S/c19-15(18-5-7-20-8-6-18)14-11-9-21-12-4-2-1-3-10(12)13(11)16-17-14/h1-4H,5-9H2,(H,16,17) |
| InChIKey | DMWJGAMVKYCYOV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-dihydrothiochromeno[4,3-c]pyrazol-3-yl(morpholin-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dihydrothiochromeno[4,3-c]pyrazol-3-yl(morpholin-4-yl)methanone?
The IUPAC name of 2,4-dihydrothiochromeno[4,3-c]pyrazol-3-yl(morpholin-4-yl)methanone (CID 123401361) is 2,4-dihydrothiochromeno[4,3-c]pyrazol-3-yl(morpholin-4-yl)methanone.
What is the SMILES notation for 2,4-dihydrothiochromeno[4,3-c]pyrazol-3-yl(morpholin-4-yl)methanone?
The canonical SMILES for 2,4-dihydrothiochromeno[4,3-c]pyrazol-3-yl(morpholin-4-yl)methanone is O=C(c1[nH]nc2c1CSc1ccccc1-2)N1CCOCC1.
What is the InChIKey of 2,4-dihydrothiochromeno[4,3-c]pyrazol-3-yl(morpholin-4-yl)methanone?
The InChIKey is DMWJGAMVKYCYOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O2S/c19-15(18-5-7-20-8-6-18)14-11-9-21-12-4-2-1-3-10(12)13(11)16-17-14/h1-4H,5-9H2,(H,16,17).
What are the key properties of 2,4-dihydrothiochromeno[4,3-c]pyrazol-3-yl(morpholin-4-yl)methanone?
2,4-dihydrothiochromeno[4,3-c]pyrazol-3-yl(morpholin-4-yl)methanone has a molecular weight of 301.37 g/mol, XLogP of 2.15, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dihydrothiochromeno[4,3-c]pyrazol-3-yl(morpholin-4-yl)methanone is sourced from PubChem (CID 123401361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).