C17H19F4NO7S — CID 123402093
[6-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxysulfonyl]-5,5,6,6-tetrafluorohexyl] acetate (PubChem CID 123402093) has the molecular formula C17H19F4NO7S and a molecular weight of 457.40 g/mol. Its IUPAC name is [6-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxysulfonyl]-5,5,6,6-tetrafluorohexyl] acetate.
| Compound Name | [6-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxysulfonyl]-5,5,6,6-tetrafluorohexyl] acetate |
|---|---|
| PubChem CID | 123402093 |
| Molecular Formula | C17H19F4NO7S |
| Molecular Weight | 457.40 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | [6-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxysulfonyl]-5,5,6,6-tetrafluorohexyl] acetate |
| SMILES | CC(=O)OCCCCC(F)(F)C(F)(F)S(=O)(=O)On1c(O)c2c(c1O)C1C=CC2C1 |
| InChI | InChI=1S/C17H19F4NO7S/c1-9(23)28-7-3-2-6-16(18,19)17(20,21)30(26,27)29-22-14(24)12-10-4-5-11(8-10)13(12)15(22)25/h4-5,10-11,24-25H,2-3,6-8H2,1H3 |
| InChIKey | AJMZHGBZIYMILM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|