C21H25N3O — CID 123402373
(1R,9R,10R)-5-(pyridin-2-ylamino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol (PubChem CID 123402373) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is (1R,9R,10R)-5-(pyridin-2-ylamino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol.
| Compound Name | (1R,9R,10R)-5-(pyridin-2-ylamino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol |
|---|---|
| PubChem CID | 123402373 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | (1R,9R,10R)-5-(pyridin-2-ylamino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol |
| SMILES | Oc1cc2c(cc1Nc1ccccn1)C[C@H]1NCC[C@@]23CCCC[C@@H]13 |
| InChI | InChI=1S/C21H25N3O/c25-19-13-16-14(12-18(19)24-20-6-2-4-9-23-20)11-17-15-5-1-3-7-21(15,16)8-10-22-17/h2,4,6,9,12-13,15,17,22,25H,1,3,5,7-8,10-11H2,(H,23,24)/t15-,17+,21+/m0/s1 |
| InChIKey | WSTJAKJAGUJXCC-LUQKVYGDSA-N |
| XLogP | 3.88 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|