About [3-(1,3,2-benzodioxaborol-2-yl)pyrrol-1-yl]-tri(propan-2-yl)silane
[3-(1,3,2-benzodioxaborol-2-yl)pyrrol-1-yl]-tri(propan-2-yl)silane (PubChem CID 123402385) has the molecular formula C19H28BNO2Si
and a molecular weight of 341.34 g/mol. Its IUPAC name is [3-(1,3,2-benzodioxaborol-2-yl)pyrrol-1-yl]-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | [3-(1,3,2-benzodioxaborol-2-yl)pyrrol-1-yl]-tri(propan-2-yl)silane |
| PubChem CID | 123402385 |
| Molecular Formula | C19H28BNO2Si |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | [3-(1,3,2-benzodioxaborol-2-yl)pyrrol-1-yl]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1ccc(B2Oc3ccccc3O2)c1 |
| InChI | InChI=1S/C19H28BNO2Si/c1-14(2)24(15(3)4,16(5)6)21-12-11-17(13-21)20-22-18-9-7-8-10-19(18)23-20/h7-16H,1-6H3 |
| InChIKey | CTXTYFGGJIYPKB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [3-(1,3,2-benzodioxaborol-2-yl)pyrrol-1-yl]-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,3,2-benzodioxaborol-2-yl)pyrrol-1-yl]-tri(propan-2-yl)silane?
The IUPAC name of [3-(1,3,2-benzodioxaborol-2-yl)pyrrol-1-yl]-tri(propan-2-yl)silane (CID 123402385) is [3-(1,3,2-benzodioxaborol-2-yl)pyrrol-1-yl]-tri(propan-2-yl)silane.
What is the SMILES notation for [3-(1,3,2-benzodioxaborol-2-yl)pyrrol-1-yl]-tri(propan-2-yl)silane?
The canonical SMILES for [3-(1,3,2-benzodioxaborol-2-yl)pyrrol-1-yl]-tri(propan-2-yl)silane is CC(C)[Si](C(C)C)(C(C)C)n1ccc(B2Oc3ccccc3O2)c1.
What is the InChIKey of [3-(1,3,2-benzodioxaborol-2-yl)pyrrol-1-yl]-tri(propan-2-yl)silane?
The InChIKey is CTXTYFGGJIYPKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28BNO2Si/c1-14(2)24(15(3)4,16(5)6)21-12-11-17(13-21)20-22-18-9-7-8-10-19(18)23-20/h7-16H,1-6H3.
What are the key properties of [3-(1,3,2-benzodioxaborol-2-yl)pyrrol-1-yl]-tri(propan-2-yl)silane?
[3-(1,3,2-benzodioxaborol-2-yl)pyrrol-1-yl]-tri(propan-2-yl)silane has a molecular weight of 341.34 g/mol, XLogP of 4.68, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,3,2-benzodioxaborol-2-yl)pyrrol-1-yl]-tri(propan-2-yl)silane is sourced from PubChem (CID 123402385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).