C14H17N3O4S — CID 1234026
7,7-bis(hydroxymethyl)-3-(4-methoxyphenyl)-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one (PubChem CID 1234026) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is 7,7-bis(hydroxymethyl)-3-(4-methoxyphenyl)-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one.
| Compound Name | 7,7-bis(hydroxymethyl)-3-(4-methoxyphenyl)-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one |
|---|---|
| PubChem CID | 1234026 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 7,7-bis(hydroxymethyl)-3-(4-methoxyphenyl)-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one |
| SMILES | COc1ccc(N2CN=C3SC(CO)(CO)C(=O)N3C2)cc1 |
| InChI | InChI=1S/C14H17N3O4S/c1-21-11-4-2-10(3-5-11)16-8-15-13-17(9-16)12(20)14(6-18,7-19)22-13/h2-5,18-19H,6-9H2,1H3 |
| InChIKey | PNDQUQUCZUGHAB-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|