C42H49F2N3O4Si — CID 123402642
N-[2-[4-[3-benzyl-5-(2,6-difluoro-4-morpholin-4-ylphenyl)-1-(2-trimethylsilylethoxymethyl)indol-2-yl]oxyphenyl]propan-2-yl]acetamide (PubChem CID 123402642) has the molecular formula C42H49F2N3O4Si and a molecular weight of 725.95 g/mol. Its IUPAC name is N-[2-[4-[3-benzyl-5-(2,6-difluoro-4-morpholin-4-ylphenyl)-1-(2-trimethylsilylethoxymethyl)indol-2-yl]oxyphenyl]propan-2-yl]acetamide.
| Compound Name | N-[2-[4-[3-benzyl-5-(2,6-difluoro-4-morpholin-4-ylphenyl)-1-(2-trimethylsilylethoxymethyl)indol-2-yl]oxyphenyl]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 123402642 |
| Molecular Formula | C42H49F2N3O4Si |
| Molecular Weight | 725.95 g/mol |
| Exact Mass | 725.35 |
| IUPAC Name | N-[2-[4-[3-benzyl-5-(2,6-difluoro-4-morpholin-4-ylphenyl)-1-(2-trimethylsilylethoxymethyl)indol-2-yl]oxyphenyl]propan-2-yl]acetamide |
| SMILES | CC(=O)NC(C)(C)c1ccc(Oc2c(Cc3ccccc3)c3cc(-c4c(F)cc(N5CCOCC5)cc4F)ccc3n2COCC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C42H49F2N3O4Si/c1-29(48)45-42(2,3)32-13-15-34(16-14-32)51-41-36(24-30-10-8-7-9-11-30)35-25-31(12-17-39(35)47(41)28-50-22-23-52(4,5)6)40-37(43)26-33(27-38(40)44)46-18-20-49-21-19-46/h7-17,25-27H,18-24,28H2,1-6H3,(H,45,48) |
| InChIKey | QNWYILXKYGYTKL-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.95 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|