C25H21ClF2N4O4 — CID 123402824
1-[2-(3-acetyl-5-isocyanatoindol-1-yl)acetyl]-N-[(3-chloro-2-fluorophenyl)methyl]-4-fluoropyrrolidine-2-carboxamide (PubChem CID 123402824) has the molecular formula C25H21ClF2N4O4 and a molecular weight of 514.92 g/mol. Its IUPAC name is 1-[2-(3-acetyl-5-isocyanatoindol-1-yl)acetyl]-N-[(3-chloro-2-fluorophenyl)methyl]-4-fluoropyrrolidine-2-carboxamide.
| Compound Name | 1-[2-(3-acetyl-5-isocyanatoindol-1-yl)acetyl]-N-[(3-chloro-2-fluorophenyl)methyl]-4-fluoropyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 123402824 |
| Molecular Formula | C25H21ClF2N4O4 |
| Molecular Weight | 514.92 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | 1-[2-(3-acetyl-5-isocyanatoindol-1-yl)acetyl]-N-[(3-chloro-2-fluorophenyl)methyl]-4-fluoropyrrolidine-2-carboxamide |
| SMILES | CC(=O)c1cn(CC(=O)N2CC(F)CC2C(=O)NCc2cccc(Cl)c2F)c2ccc(N=C=O)cc12 |
| InChI | InChI=1S/C25H21ClF2N4O4/c1-14(34)19-11-31(21-6-5-17(30-13-33)8-18(19)21)12-23(35)32-10-16(27)7-22(32)25(36)29-9-15-3-2-4-20(26)24(15)28/h2-6,8,11,16,22H,7,9-10,12H2,1H3,(H,29,36) |
| InChIKey | SMBYCUBZTAUWIA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.92 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|