About 4-hydroxy-2,3-dimethyl-5-prop-2-ynyl-1H-pyrimidin-3-ium-6-one
4-hydroxy-2,3-dimethyl-5-prop-2-ynyl-1H-pyrimidin-3-ium-6-one (PubChem CID 123402900) has the molecular formula C9H11N2O2+
and a molecular weight of 179.20 g/mol. Its IUPAC name is 4-hydroxy-2,3-dimethyl-5-prop-2-ynyl-1H-pyrimidin-3-ium-6-one.
Molecular Properties
| Compound Name | 4-hydroxy-2,3-dimethyl-5-prop-2-ynyl-1H-pyrimidin-3-ium-6-one |
| PubChem CID | 123402900 |
| Molecular Formula | C9H11N2O2+ |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 4-hydroxy-2,3-dimethyl-5-prop-2-ynyl-1H-pyrimidin-3-ium-6-one |
| SMILES | C#CCc1c(O)[n+](C)c(C)[nH]c1=O |
| InChI | InChI=1S/C9H10N2O2/c1-4-5-7-8(12)10-6(2)11(3)9(7)13/h1H,5H2,2-3H3,(H,12,13)/p+1 |
| InChIKey | NFUUJTUYGMWWGE-UHFFFAOYSA-O |
| XLogP | -0.61 |
| TPSA | 56.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-2,3-dimethyl-5-prop-2-ynyl-1H-pyrimidin-3-ium-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2,3-dimethyl-5-prop-2-ynyl-1H-pyrimidin-3-ium-6-one?
The IUPAC name of 4-hydroxy-2,3-dimethyl-5-prop-2-ynyl-1H-pyrimidin-3-ium-6-one (CID 123402900) is 4-hydroxy-2,3-dimethyl-5-prop-2-ynyl-1H-pyrimidin-3-ium-6-one.
What is the SMILES notation for 4-hydroxy-2,3-dimethyl-5-prop-2-ynyl-1H-pyrimidin-3-ium-6-one?
The canonical SMILES for 4-hydroxy-2,3-dimethyl-5-prop-2-ynyl-1H-pyrimidin-3-ium-6-one is C#CCc1c(O)[n+](C)c(C)[nH]c1=O.
What is the InChIKey of 4-hydroxy-2,3-dimethyl-5-prop-2-ynyl-1H-pyrimidin-3-ium-6-one?
The InChIKey is NFUUJTUYGMWWGE-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H10N2O2/c1-4-5-7-8(12)10-6(2)11(3)9(7)13/h1H,5H2,2-3H3,(H,12,13)/p+1.
What are the key properties of 4-hydroxy-2,3-dimethyl-5-prop-2-ynyl-1H-pyrimidin-3-ium-6-one?
4-hydroxy-2,3-dimethyl-5-prop-2-ynyl-1H-pyrimidin-3-ium-6-one has a molecular weight of 179.20 g/mol, XLogP of -0.61, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2,3-dimethyl-5-prop-2-ynyl-1H-pyrimidin-3-ium-6-one is sourced from PubChem (CID 123402900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).