C24H34NO+ — CID 123403209
(3S,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-17-pyridin-1-ium-1-yl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 123403209) has the molecular formula C24H34NO+ and a molecular weight of 352.54 g/mol. Its IUPAC name is (3S,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-17-pyridin-1-ium-1-yl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-17-pyridin-1-ium-1-yl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 123403209 |
| Molecular Formula | C24H34NO+ |
| Molecular Weight | 352.54 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | (3S,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-17-pyridin-1-ium-1-yl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CC[C@H](O)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)C([n+]3ccccc3)=CC[C@@H]12 |
| InChI | InChI=1S/C24H34NO/c1-23-12-10-18(26)16-17(23)6-7-19-20-8-9-22(25-14-4-3-5-15-25)24(20,2)13-11-21(19)23/h3-5,9,14-15,17-21,26H,6-8,10-13,16H2,1-2H3/q+1/t17-,18-,19-,20-,21-,23-,24-/m0/s1 |
| InChIKey | DMPVBKRIZBGSEE-DJKVCXMVSA-N |
| XLogP | 4.83 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.54 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|