About (E)-4-bromohex-3-ene-1,2-diimine
(E)-4-bromohex-3-ene-1,2-diimine (PubChem CID 123403340) has the molecular formula C6H9BrN2
and a molecular weight of 189.06 g/mol. Its IUPAC name is (E)-4-bromohex-3-ene-1,2-diimine.
Molecular Properties
| Compound Name | (E)-4-bromohex-3-ene-1,2-diimine |
| PubChem CID | 123403340 |
| Molecular Formula | C6H9BrN2 |
| Molecular Weight | 189.06 g/mol |
| Exact Mass | 187.99 |
| IUPAC Name | (E)-4-bromohex-3-ene-1,2-diimine |
| SMILES | [H]/N=C(\C=N\[H])/C=C(/Br)CC |
| InChI | InChI=1S/C6H9BrN2/c1-2-5(7)3-6(9)4-8/h3-4,8-9H,2H2,1H3/b5-3+,8-4+,9-6- |
| InChIKey | CUQIUICFMSBUFE-RFWXLYLGSA-N |
| XLogP | 2.34 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.06 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-bromohex-3-ene-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-bromohex-3-ene-1,2-diimine?
The IUPAC name of (E)-4-bromohex-3-ene-1,2-diimine (CID 123403340) is (E)-4-bromohex-3-ene-1,2-diimine.
What is the SMILES notation for (E)-4-bromohex-3-ene-1,2-diimine?
The canonical SMILES for (E)-4-bromohex-3-ene-1,2-diimine is [H]/N=C(\C=N\[H])/C=C(/Br)CC.
What is the InChIKey of (E)-4-bromohex-3-ene-1,2-diimine?
The InChIKey is CUQIUICFMSBUFE-RFWXLYLGSA-N. The full InChI is InChI=1S/C6H9BrN2/c1-2-5(7)3-6(9)4-8/h3-4,8-9H,2H2,1H3/b5-3+,8-4+,9-6-.
What are the key properties of (E)-4-bromohex-3-ene-1,2-diimine?
(E)-4-bromohex-3-ene-1,2-diimine has a molecular weight of 189.06 g/mol, XLogP of 2.34, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-bromohex-3-ene-1,2-diimine is sourced from PubChem (CID 123403340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).