About tert-butyl N-[1-[4-(2-acetamido-4-pyridinyl)-2-chlorophenoxy]-4-methylpentan-2-yl]carbamate
tert-butyl N-[1-[4-(2-acetamido-4-pyridinyl)-2-chlorophenoxy]-4-methylpentan-2-yl]carbamate (PubChem CID 123403660) has the molecular formula C24H32ClN3O4
and a molecular weight of 461.99 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(2-acetamido-4-pyridinyl)-2-chlorophenoxy]-4-methylpentan-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[1-[4-(2-acetamido-4-pyridinyl)-2-chlorophenoxy]-4-methylpentan-2-yl]carbamate |
| PubChem CID | 123403660 |
| Molecular Formula | C24H32ClN3O4 |
| Molecular Weight | 461.99 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | tert-butyl N-[1-[4-(2-acetamido-4-pyridinyl)-2-chlorophenoxy]-4-methylpentan-2-yl]carbamate |
| SMILES | CC(=O)Nc1cc(-c2ccc(OCC(CC(C)C)NC(=O)OC(C)(C)C)c(Cl)c2)ccn1 |
| InChI | InChI=1S/C24H32ClN3O4/c1-15(2)11-19(28-23(30)32-24(4,5)6)14-31-21-8-7-17(12-20(21)25)18-9-10-26-22(13-18)27-16(3)29/h7-10,12-13,15,19H,11,14H2,1-6H3,(H,28,30)(H,26,27,29) |
| InChIKey | ZIAMUKTTXRPYST-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.99 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[1-[4-(2-acetamido-4-pyridinyl)-2-chlorophenoxy]-4-methylpentan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[1-[4-(2-acetamido-4-pyridinyl)-2-chlorophenoxy]-4-methylpentan-2-yl]carbamate?
The IUPAC name of tert-butyl N-[1-[4-(2-acetamido-4-pyridinyl)-2-chlorophenoxy]-4-methylpentan-2-yl]carbamate (CID 123403660) is tert-butyl N-[1-[4-(2-acetamido-4-pyridinyl)-2-chlorophenoxy]-4-methylpentan-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[1-[4-(2-acetamido-4-pyridinyl)-2-chlorophenoxy]-4-methylpentan-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[1-[4-(2-acetamido-4-pyridinyl)-2-chlorophenoxy]-4-methylpentan-2-yl]carbamate is CC(=O)Nc1cc(-c2ccc(OCC(CC(C)C)NC(=O)OC(C)(C)C)c(Cl)c2)ccn1.
What is the InChIKey of tert-butyl N-[1-[4-(2-acetamido-4-pyridinyl)-2-chlorophenoxy]-4-methylpentan-2-yl]carbamate?
The InChIKey is ZIAMUKTTXRPYST-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H32ClN3O4/c1-15(2)11-19(28-23(30)32-24(4,5)6)14-31-21-8-7-17(12-20(21)25)18-9-10-26-22(13-18)27-16(3)29/h7-10,12-13,15,19H,11,14H2,1-6H3,(H,28,30)(H,26,27,29).
What are the key properties of tert-butyl N-[1-[4-(2-acetamido-4-pyridinyl)-2-chlorophenoxy]-4-methylpentan-2-yl]carbamate?
tert-butyl N-[1-[4-(2-acetamido-4-pyridinyl)-2-chlorophenoxy]-4-methylpentan-2-yl]carbamate has a molecular weight of 461.99 g/mol, XLogP of 5.68, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[1-[4-(2-acetamido-4-pyridinyl)-2-chlorophenoxy]-4-methylpentan-2-yl]carbamate is sourced from PubChem (CID 123403660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).