C17H22O5S — CID 123403772
[4-(5-cyclohexa-1,3-dien-1-yl-1,3-dioxan-2-yl)cyclohexa-1,3-dien-1-yl] methanesulfonate (PubChem CID 123403772) has the molecular formula C17H22O5S and a molecular weight of 338.42 g/mol. Its IUPAC name is [4-(5-cyclohexa-1,3-dien-1-yl-1,3-dioxan-2-yl)cyclohexa-1,3-dien-1-yl] methanesulfonate.
| Compound Name | [4-(5-cyclohexa-1,3-dien-1-yl-1,3-dioxan-2-yl)cyclohexa-1,3-dien-1-yl] methanesulfonate |
|---|---|
| PubChem CID | 123403772 |
| Molecular Formula | C17H22O5S |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | [4-(5-cyclohexa-1,3-dien-1-yl-1,3-dioxan-2-yl)cyclohexa-1,3-dien-1-yl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1=CC=C(C2OCC(C3=CC=CCC3)CO2)CC1 |
| InChI | InChI=1S/C17H22O5S/c1-23(18,19)22-16-9-7-14(8-10-16)17-20-11-15(12-21-17)13-5-3-2-4-6-13/h2-3,5,7,9,15,17H,4,6,8,10-12H2,1H3 |
| InChIKey | YQQMDSLUMPSIKA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|