About N-[3,3-dimethylbut-1-enyl(ethylamino)silyl]ethanamine
N-[3,3-dimethylbut-1-enyl(ethylamino)silyl]ethanamine (PubChem CID 123404164) has the molecular formula C10H24N2Si
and a molecular weight of 200.40 g/mol. Its IUPAC name is N-[3,3-dimethylbut-1-enyl(ethylamino)silyl]ethanamine.
Molecular Properties
| Compound Name | N-[3,3-dimethylbut-1-enyl(ethylamino)silyl]ethanamine |
| PubChem CID | 123404164 |
| Molecular Formula | C10H24N2Si |
| Molecular Weight | 200.40 g/mol |
| Exact Mass | 200.17 |
| IUPAC Name | N-[3,3-dimethylbut-1-enyl(ethylamino)silyl]ethanamine |
| SMILES | CCN[SiH](C=CC(C)(C)C)NCC |
| InChI | InChI=1S/C10H24N2Si/c1-6-11-13(12-7-2)9-8-10(3,4)5/h8-9,11-13H,6-7H2,1-5H3 |
| InChIKey | QCMHTMQTLWQUIZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-[3,3-dimethylbut-1-enyl(ethylamino)silyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,3-dimethylbut-1-enyl(ethylamino)silyl]ethanamine?
The IUPAC name of N-[3,3-dimethylbut-1-enyl(ethylamino)silyl]ethanamine (CID 123404164) is N-[3,3-dimethylbut-1-enyl(ethylamino)silyl]ethanamine.
What is the SMILES notation for N-[3,3-dimethylbut-1-enyl(ethylamino)silyl]ethanamine?
The canonical SMILES for N-[3,3-dimethylbut-1-enyl(ethylamino)silyl]ethanamine is CCN[SiH](C=CC(C)(C)C)NCC.
What is the InChIKey of N-[3,3-dimethylbut-1-enyl(ethylamino)silyl]ethanamine?
The InChIKey is QCMHTMQTLWQUIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N2Si/c1-6-11-13(12-7-2)9-8-10(3,4)5/h8-9,11-13H,6-7H2,1-5H3.
What are the key properties of N-[3,3-dimethylbut-1-enyl(ethylamino)silyl]ethanamine?
N-[3,3-dimethylbut-1-enyl(ethylamino)silyl]ethanamine has a molecular weight of 200.40 g/mol, XLogP of 1.57, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,3-dimethylbut-1-enyl(ethylamino)silyl]ethanamine is sourced from PubChem (CID 123404164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).