C26H19F3O6S — CID 123404193
methyl 3-[4-[[6-methoxy-1-oxo-2-[4-(trifluoromethoxy)phenyl]-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoate (PubChem CID 123404193) has the molecular formula C26H19F3O6S and a molecular weight of 516.49 g/mol. Its IUPAC name is methyl 3-[4-[[6-methoxy-1-oxo-2-[4-(trifluoromethoxy)phenyl]-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoate.
| Compound Name | methyl 3-[4-[[6-methoxy-1-oxo-2-[4-(trifluoromethoxy)phenyl]-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 123404193 |
| Molecular Formula | C26H19F3O6S |
| Molecular Weight | 516.49 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | methyl 3-[4-[[6-methoxy-1-oxo-2-[4-(trifluoromethoxy)phenyl]-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1ccc(OC2=C(c3ccc(OC(F)(F)F)cc3)S(=O)c3cc(OC)ccc32)cc1 |
| InChI | InChI=1S/C26H19F3O6S/c1-32-20-12-13-21-22(15-20)36(31)25(17-6-10-19(11-7-17)35-26(27,28)29)24(21)34-18-8-3-16(4-9-18)5-14-23(30)33-2/h3-15H,1-2H3 |
| InChIKey | NGJKYTXZXSIWIL-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.49 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|