C24H38O5Si — CID 123404276
3,3-dimethyl-2-[[(2S,3R)-3-(6-trimethylsilylhexa-1,3-dien-5-ynyl)-1,4-dioxaspiro[4.5]decan-2-yl]methoxy]butanoic acid (PubChem CID 123404276) has the molecular formula C24H38O5Si and a molecular weight of 434.65 g/mol. Its IUPAC name is 3,3-dimethyl-2-[[(2S,3R)-3-(6-trimethylsilylhexa-1,3-dien-5-ynyl)-1,4-dioxaspiro[4.5]decan-2-yl]methoxy]butanoic acid.
| Compound Name | 3,3-dimethyl-2-[[(2S,3R)-3-(6-trimethylsilylhexa-1,3-dien-5-ynyl)-1,4-dioxaspiro[4.5]decan-2-yl]methoxy]butanoic acid |
|---|---|
| PubChem CID | 123404276 |
| Molecular Formula | C24H38O5Si |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | 3,3-dimethyl-2-[[(2S,3R)-3-(6-trimethylsilylhexa-1,3-dien-5-ynyl)-1,4-dioxaspiro[4.5]decan-2-yl]methoxy]butanoic acid |
| SMILES | CC(C)(C)C(OC[C@@H]1OC2(CCCCC2)O[C@@H]1C=CC=CC#C[Si](C)(C)C)C(=O)O |
| InChI | InChI=1S/C24H38O5Si/c1-23(2,3)21(22(25)26)27-18-20-19(14-10-7-8-13-17-30(4,5)6)28-24(29-20)15-11-9-12-16-24/h7-8,10,14,19-21H,9,11-12,15-16,18H2,1-6H3,(H,25,26)/t19-,20+,21?/m1/s1 |
| InChIKey | PUMFINBVFHQNLE-PDYHCXRVSA-N |
| XLogP | 4.94 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|