C27H26F2N2O2+2 — CID 123404457
4-[(6,7-diethyl-9,11-difluoro-6-methylbenzo[a]quinolizin-5-ium-7-yl)methyl]pyrido[2,1-c][1,4]oxazin-5-ium-1-one (PubChem CID 123404457) has the molecular formula C27H26F2N2O2+2 and a molecular weight of 448.51 g/mol. Its IUPAC name is 4-[(6,7-diethyl-9,11-difluoro-6-methylbenzo[a]quinolizin-5-ium-7-yl)methyl]pyrido[2,1-c][1,4]oxazin-5-ium-1-one.
| Compound Name | 4-[(6,7-diethyl-9,11-difluoro-6-methylbenzo[a]quinolizin-5-ium-7-yl)methyl]pyrido[2,1-c][1,4]oxazin-5-ium-1-one |
|---|---|
| PubChem CID | 123404457 |
| Molecular Formula | C27H26F2N2O2+2 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 4-[(6,7-diethyl-9,11-difluoro-6-methylbenzo[a]quinolizin-5-ium-7-yl)methyl]pyrido[2,1-c][1,4]oxazin-5-ium-1-one |
| SMILES | CCC1(Cc2coc(=O)c3cccc[n+]23)c2cc(F)cc(F)c2-c2cccc[n+]2C1(C)CC |
| InChI | InChI=1S/C27H26F2N2O2/c1-4-26(3)27(5-2,16-19-17-33-25(32)23-11-6-8-12-30(19)23)20-14-18(28)15-21(29)24(20)22-10-7-9-13-31(22)26/h6-15,17H,4-5,16H2,1-3H3/q+2 |
| InChIKey | PNHYZOHBZUADSF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 38.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|