C21H32N2O — CID 123404493
(3E,6Z,8Z)-N-hexyl-2-methanimidoyl-4,7-dimethyl-5-methylideneundeca-3,6,8,10-tetraenamide (PubChem CID 123404493) has the molecular formula C21H32N2O and a molecular weight of 328.50 g/mol. Its IUPAC name is (3E,6Z,8Z)-N-hexyl-2-methanimidoyl-4,7-dimethyl-5-methylideneundeca-3,6,8,10-tetraenamide.
| Compound Name | (3E,6Z,8Z)-N-hexyl-2-methanimidoyl-4,7-dimethyl-5-methylideneundeca-3,6,8,10-tetraenamide |
|---|---|
| PubChem CID | 123404493 |
| Molecular Formula | C21H32N2O |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | (3E,6Z,8Z)-N-hexyl-2-methanimidoyl-4,7-dimethyl-5-methylideneundeca-3,6,8,10-tetraenamide |
| SMILES | [H]/N=C/C(/C=C(\C)C(=C)/C=C(C)\C=C/C=C)C(=O)NCCCCCC |
| InChI | InChI=1S/C21H32N2O/c1-6-8-10-11-13-23-21(24)20(16-22)15-19(5)18(4)14-17(3)12-9-7-2/h7,9,12,14-16,20,22H,2,4,6,8,10-11,13H2,1,3,5H3,(H,23,24)/b12-9-,17-14-,19-15+,22-16+ |
| InChIKey | RMAFZGWTSUSGKH-UFFLWKEUSA-N |
| XLogP | 5.14 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|