C13H24N3O+ — CID 123404649
5-(4,4-dimethylpiperazin-4-ium-1-yl)-4-methyl-2-methylidenepent-3-enamide (PubChem CID 123404649) has the molecular formula C13H24N3O+ and a molecular weight of 238.35 g/mol. Its IUPAC name is 5-(4,4-dimethylpiperazin-4-ium-1-yl)-4-methyl-2-methylidenepent-3-enamide.
| Compound Name | 5-(4,4-dimethylpiperazin-4-ium-1-yl)-4-methyl-2-methylidenepent-3-enamide |
|---|---|
| PubChem CID | 123404649 |
| Molecular Formula | C13H24N3O+ |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 5-(4,4-dimethylpiperazin-4-ium-1-yl)-4-methyl-2-methylidenepent-3-enamide |
| SMILES | C=C(C=C(C)CN1CC[N+](C)(C)CC1)C(N)=O |
| InChI | InChI=1S/C13H23N3O/c1-11(9-12(2)13(14)17)10-15-5-7-16(3,4)8-6-15/h9H,2,5-8,10H2,1,3-4H3,(H-,14,17)/p+1 |
| InChIKey | ROUFUNGBNZPZCH-UHFFFAOYSA-O |
| XLogP | 0.37 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|