C27H33F4N — CID 123404835
9-ethyl-10-fluoro-3,3,6,11-tetramethyl-11-[3-(trifluoromethyl)phenyl]-2,4,6,7,8,9-hexahydro-1H-cyclohepta[b]quinoline (PubChem CID 123404835) has the molecular formula C27H33F4N and a molecular weight of 447.56 g/mol. Its IUPAC name is 9-ethyl-10-fluoro-3,3,6,11-tetramethyl-11-[3-(trifluoromethyl)phenyl]-2,4,6,7,8,9-hexahydro-1H-cyclohepta[b]quinoline.
| Compound Name | 9-ethyl-10-fluoro-3,3,6,11-tetramethyl-11-[3-(trifluoromethyl)phenyl]-2,4,6,7,8,9-hexahydro-1H-cyclohepta[b]quinoline |
|---|---|
| PubChem CID | 123404835 |
| Molecular Formula | C27H33F4N |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 9-ethyl-10-fluoro-3,3,6,11-tetramethyl-11-[3-(trifluoromethyl)phenyl]-2,4,6,7,8,9-hexahydro-1H-cyclohepta[b]quinoline |
| SMILES | CCC1CCC(C)C2=NC3=C(CCC(C)(C)C3)C(C)(c3cccc(C(F)(F)F)c3)C2=C1F |
| InChI | InChI=1S/C27H33F4N/c1-6-17-11-10-16(2)24-22(23(17)28)26(5,18-8-7-9-19(14-18)27(29,30)31)20-12-13-25(3,4)15-21(20)32-24/h7-9,14,16-17H,6,10-13,15H2,1-5H3 |
| InChIKey | NADBCRTXFPENKY-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |