C21H32N2 — CID 123404948
1-(4,6-dimethylhepta-2,4,6-trien-3-yl)-3-(2,4,6-trimethylcyclohexa-1,3-dien-1-yl)imidazolidine (PubChem CID 123404948) has the molecular formula C21H32N2 and a molecular weight of 312.50 g/mol. Its IUPAC name is 1-(4,6-dimethylhepta-2,4,6-trien-3-yl)-3-(2,4,6-trimethylcyclohexa-1,3-dien-1-yl)imidazolidine.
| Compound Name | 1-(4,6-dimethylhepta-2,4,6-trien-3-yl)-3-(2,4,6-trimethylcyclohexa-1,3-dien-1-yl)imidazolidine |
|---|---|
| PubChem CID | 123404948 |
| Molecular Formula | C21H32N2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.26 |
| IUPAC Name | 1-(4,6-dimethylhepta-2,4,6-trien-3-yl)-3-(2,4,6-trimethylcyclohexa-1,3-dien-1-yl)imidazolidine |
| SMILES | C=C(C)C=C(C)C(=CC)N1CCN(C2=C(C)C=C(C)CC2C)C1 |
| InChI | InChI=1S/C21H32N2/c1-8-20(17(5)11-15(2)3)22-9-10-23(14-22)21-18(6)12-16(4)13-19(21)7/h8,11-12,19H,2,9-10,13-14H2,1,3-7H3 |
| InChIKey | NXXJEHDHSBACGU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|