C18H15N7O2S — CID 1234051
3-(benzotriazol-1-ylmethyl)-6-(3,4-dimethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 1234051) has the molecular formula C18H15N7O2S and a molecular weight of 393.43 g/mol. Its IUPAC name is 3-(benzotriazol-1-ylmethyl)-6-(3,4-dimethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-(benzotriazol-1-ylmethyl)-6-(3,4-dimethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 1234051 |
| Molecular Formula | C18H15N7O2S |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 3-(benzotriazol-1-ylmethyl)-6-(3,4-dimethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | COc1ccc(-c2nn3c(Cn4nnc5ccccc54)nnc3s2)cc1OC |
| InChI | InChI=1S/C18H15N7O2S/c1-26-14-8-7-11(9-15(14)27-2)17-22-25-16(20-21-18(25)28-17)10-24-13-6-4-3-5-12(13)19-23-24/h3-9H,10H2,1-2H3 |
| InChIKey | RANKGVWAJDCLRT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 92.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |