About tert-butyl carbamate;2-tert-butyl-7-ethylsulfonyl-6-methyl-1,3-benzoxazole
tert-butyl carbamate;2-tert-butyl-7-ethylsulfonyl-6-methyl-1,3-benzoxazole (PubChem CID 123405158) has the molecular formula C19H30N2O5S
and a molecular weight of 398.53 g/mol. Its IUPAC name is tert-butyl carbamate;2-tert-butyl-7-ethylsulfonyl-6-methyl-1,3-benzoxazole.
Molecular Properties
| Compound Name | tert-butyl carbamate;2-tert-butyl-7-ethylsulfonyl-6-methyl-1,3-benzoxazole |
| PubChem CID | 123405158 |
| Molecular Formula | C19H30N2O5S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | tert-butyl carbamate;2-tert-butyl-7-ethylsulfonyl-6-methyl-1,3-benzoxazole |
| SMILES | CC(C)(C)OC(N)=O.CCS(=O)(=O)c1c(C)ccc2nc(C(C)(C)C)oc12 |
| InChI | InChI=1S/C14H19NO3S.C5H11NO2/c1-6-19(16,17)12-9(2)7-8-10-11(12)18-13(15-10)14(3,4)5;1-5(2,3)8-4(6)7/h7-8H,6H2,1-5H3;1-3H3,(H2,6,7) |
| InChIKey | VPIXLZQWLDJGFG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl carbamate;2-tert-butyl-7-ethylsulfonyl-6-methyl-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl carbamate;2-tert-butyl-7-ethylsulfonyl-6-methyl-1,3-benzoxazole?
The IUPAC name of tert-butyl carbamate;2-tert-butyl-7-ethylsulfonyl-6-methyl-1,3-benzoxazole (CID 123405158) is tert-butyl carbamate;2-tert-butyl-7-ethylsulfonyl-6-methyl-1,3-benzoxazole.
What is the SMILES notation for tert-butyl carbamate;2-tert-butyl-7-ethylsulfonyl-6-methyl-1,3-benzoxazole?
The canonical SMILES for tert-butyl carbamate;2-tert-butyl-7-ethylsulfonyl-6-methyl-1,3-benzoxazole is CC(C)(C)OC(N)=O.CCS(=O)(=O)c1c(C)ccc2nc(C(C)(C)C)oc12.
What is the InChIKey of tert-butyl carbamate;2-tert-butyl-7-ethylsulfonyl-6-methyl-1,3-benzoxazole?
The InChIKey is VPIXLZQWLDJGFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3S.C5H11NO2/c1-6-19(16,17)12-9(2)7-8-10-11(12)18-13(15-10)14(3,4)5;1-5(2,3)8-4(6)7/h7-8H,6H2,1-5H3;1-3H3,(H2,6,7).
What are the key properties of tert-butyl carbamate;2-tert-butyl-7-ethylsulfonyl-6-methyl-1,3-benzoxazole?
tert-butyl carbamate;2-tert-butyl-7-ethylsulfonyl-6-methyl-1,3-benzoxazole has a molecular weight of 398.53 g/mol, XLogP of 4.11, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl carbamate;2-tert-butyl-7-ethylsulfonyl-6-methyl-1,3-benzoxazole is sourced from PubChem (CID 123405158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).