C22H23F5N2 — CID 123405358
N-[[3-(1,1-difluoroethyl)-5-(trifluoromethyl)phenyl]methyl]-1-(4-phenylpyrrolidin-2-yl)ethanimine (PubChem CID 123405358) has the molecular formula C22H23F5N2 and a molecular weight of 410.43 g/mol. Its IUPAC name is N-[[3-(1,1-difluoroethyl)-5-(trifluoromethyl)phenyl]methyl]-1-(4-phenylpyrrolidin-2-yl)ethanimine.
| Compound Name | N-[[3-(1,1-difluoroethyl)-5-(trifluoromethyl)phenyl]methyl]-1-(4-phenylpyrrolidin-2-yl)ethanimine |
|---|---|
| PubChem CID | 123405358 |
| Molecular Formula | C22H23F5N2 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | N-[[3-(1,1-difluoroethyl)-5-(trifluoromethyl)phenyl]methyl]-1-(4-phenylpyrrolidin-2-yl)ethanimine |
| SMILES | C/C(=N\Cc1cc(C(C)(F)F)cc(C(F)(F)F)c1)C1CC(c2ccccc2)CN1 |
| InChI | InChI=1S/C22H23F5N2/c1-14(20-10-17(13-29-20)16-6-4-3-5-7-16)28-12-15-8-18(21(2,23)24)11-19(9-15)22(25,26)27/h3-9,11,17,20,29H,10,12-13H2,1-2H3/b28-14+ |
| InChIKey | XEYPCTYWNZKLLG-CCVNUDIWSA-N |
| XLogP | 5.92 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|