About 1-methyl-5-octan-4-yl-2,5-dihydrotetrazole
1-methyl-5-octan-4-yl-2,5-dihydrotetrazole (PubChem CID 123405639) has the molecular formula C10H22N4
and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-methyl-5-octan-4-yl-2,5-dihydrotetrazole.
Molecular Properties
| Compound Name | 1-methyl-5-octan-4-yl-2,5-dihydrotetrazole |
| PubChem CID | 123405639 |
| Molecular Formula | C10H22N4 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | 1-methyl-5-octan-4-yl-2,5-dihydrotetrazole |
| SMILES | CCCCC(CCC)C1N=NNN1C |
| InChI | InChI=1S/C10H22N4/c1-4-6-8-9(7-5-2)10-11-12-13-14(10)3/h9-10H,4-8H2,1-3H3,(H,11,13) |
| InChIKey | UWVQMAQSZRDHDR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-5-octan-4-yl-2,5-dihydrotetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5-octan-4-yl-2,5-dihydrotetrazole?
The IUPAC name of 1-methyl-5-octan-4-yl-2,5-dihydrotetrazole (CID 123405639) is 1-methyl-5-octan-4-yl-2,5-dihydrotetrazole.
What is the SMILES notation for 1-methyl-5-octan-4-yl-2,5-dihydrotetrazole?
The canonical SMILES for 1-methyl-5-octan-4-yl-2,5-dihydrotetrazole is CCCCC(CCC)C1N=NNN1C.
What is the InChIKey of 1-methyl-5-octan-4-yl-2,5-dihydrotetrazole?
The InChIKey is UWVQMAQSZRDHDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N4/c1-4-6-8-9(7-5-2)10-11-12-13-14(10)3/h9-10H,4-8H2,1-3H3,(H,11,13).
What are the key properties of 1-methyl-5-octan-4-yl-2,5-dihydrotetrazole?
1-methyl-5-octan-4-yl-2,5-dihydrotetrazole has a molecular weight of 198.31 g/mol, XLogP of 2.74, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5-octan-4-yl-2,5-dihydrotetrazole is sourced from PubChem (CID 123405639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).