C21H12ClF2N5OS — CID 123406152
4-[2-[[6-chloro-3,5-dicyano-4-(3,4-difluorophenyl)-2-pyridinyl]sulfanyl]ethyl]pyridine-2-carboxamide (PubChem CID 123406152) has the molecular formula C21H12ClF2N5OS and a molecular weight of 455.88 g/mol. Its IUPAC name is 4-[2-[[6-chloro-3,5-dicyano-4-(3,4-difluorophenyl)-2-pyridinyl]sulfanyl]ethyl]pyridine-2-carboxamide.
| Compound Name | 4-[2-[[6-chloro-3,5-dicyano-4-(3,4-difluorophenyl)-2-pyridinyl]sulfanyl]ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 123406152 |
| Molecular Formula | C21H12ClF2N5OS |
| Molecular Weight | 455.88 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | 4-[2-[[6-chloro-3,5-dicyano-4-(3,4-difluorophenyl)-2-pyridinyl]sulfanyl]ethyl]pyridine-2-carboxamide |
| SMILES | N#Cc1c(Cl)nc(SCCc2ccnc(C(N)=O)c2)c(C#N)c1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C21H12ClF2N5OS/c22-19-13(9-25)18(12-1-2-15(23)16(24)8-12)14(10-26)21(29-19)31-6-4-11-3-5-28-17(7-11)20(27)30/h1-3,5,7-8H,4,6H2,(H2,27,30) |
| InChIKey | QOEMHKKUZVKHFV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.88 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|