About 1-(cyclopropylmethyl)-4-methyl-3-methylidene-1,4-diazepan-2-one
1-(cyclopropylmethyl)-4-methyl-3-methylidene-1,4-diazepan-2-one (PubChem CID 123406540) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-4-methyl-3-methylidene-1,4-diazepan-2-one.
Molecular Properties
| Compound Name | 1-(cyclopropylmethyl)-4-methyl-3-methylidene-1,4-diazepan-2-one |
| PubChem CID | 123406540 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 1-(cyclopropylmethyl)-4-methyl-3-methylidene-1,4-diazepan-2-one |
| SMILES | C=C1C(=O)N(CC2CC2)CCCN1C |
| InChI | InChI=1S/C11H18N2O/c1-9-11(14)13(8-10-4-5-10)7-3-6-12(9)2/h10H,1,3-8H2,2H3 |
| InChIKey | GTQHUXZMOKWUFY-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(cyclopropylmethyl)-4-methyl-3-methylidene-1,4-diazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclopropylmethyl)-4-methyl-3-methylidene-1,4-diazepan-2-one?
The IUPAC name of 1-(cyclopropylmethyl)-4-methyl-3-methylidene-1,4-diazepan-2-one (CID 123406540) is 1-(cyclopropylmethyl)-4-methyl-3-methylidene-1,4-diazepan-2-one.
What is the SMILES notation for 1-(cyclopropylmethyl)-4-methyl-3-methylidene-1,4-diazepan-2-one?
The canonical SMILES for 1-(cyclopropylmethyl)-4-methyl-3-methylidene-1,4-diazepan-2-one is C=C1C(=O)N(CC2CC2)CCCN1C.
What is the InChIKey of 1-(cyclopropylmethyl)-4-methyl-3-methylidene-1,4-diazepan-2-one?
The InChIKey is GTQHUXZMOKWUFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O/c1-9-11(14)13(8-10-4-5-10)7-3-6-12(9)2/h10H,1,3-8H2,2H3.
What are the key properties of 1-(cyclopropylmethyl)-4-methyl-3-methylidene-1,4-diazepan-2-one?
1-(cyclopropylmethyl)-4-methyl-3-methylidene-1,4-diazepan-2-one has a molecular weight of 194.28 g/mol, XLogP of 1.07, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclopropylmethyl)-4-methyl-3-methylidene-1,4-diazepan-2-one is sourced from PubChem (CID 123406540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).