C21H23N3O4 — CID 123406731
3-[6-[(3-ethyl-3-methyl-1H-2-benzofuran-4-yl)oxy]-3-pyridinyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 123406731) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 3-[6-[(3-ethyl-3-methyl-1H-2-benzofuran-4-yl)oxy]-3-pyridinyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[6-[(3-ethyl-3-methyl-1H-2-benzofuran-4-yl)oxy]-3-pyridinyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 123406731 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 3-[6-[(3-ethyl-3-methyl-1H-2-benzofuran-4-yl)oxy]-3-pyridinyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CCC1(C)OCc2cccc(Oc3ccc(N4C(=O)NC(C)(C)C4=O)cn3)c21 |
| InChI | InChI=1S/C21H23N3O4/c1-5-21(4)17-13(12-27-21)7-6-8-15(17)28-16-10-9-14(11-22-16)24-18(25)20(2,3)23-19(24)26/h6-11H,5,12H2,1-4H3,(H,23,26) |
| InChIKey | NVYRARXUOSBJKF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|