C15H32 — CID 123406738
3,4,7-trimethyldodecane (PubChem CID 123406738) has the molecular formula C15H32 and a molecular weight of 212.42 g/mol. Its IUPAC name is 3,4,7-trimethyldodecane.
| Compound Name | 3,4,7-trimethyldodecane |
|---|---|
| PubChem CID | 123406738 |
| Molecular Formula | C15H32 |
| Molecular Weight | 212.42 g/mol |
| Exact Mass | 212.25 |
| IUPAC Name | 3,4,7-trimethyldodecane |
| SMILES | CCCCCC(C)CCC(C)C(C)CC |
| InChI | InChI=1S/C15H32/c1-6-8-9-10-13(3)11-12-15(5)14(4)7-2/h13-15H,6-12H2,1-5H3 |
| InChIKey | UOBHCQOJEIGJBM-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.42 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|