About 1-aminopentane-1,3,4-triol
1-aminopentane-1,3,4-triol (PubChem CID 123407087) has the molecular formula C5H13NO3
and a molecular weight of 135.16 g/mol. Its IUPAC name is 1-aminopentane-1,3,4-triol.
Molecular Properties
| Compound Name | 1-aminopentane-1,3,4-triol |
| PubChem CID | 123407087 |
| Molecular Formula | C5H13NO3 |
| Molecular Weight | 135.16 g/mol |
| Exact Mass | 135.09 |
| IUPAC Name | 1-aminopentane-1,3,4-triol |
| SMILES | CC(O)C(O)CC(N)O |
| InChI | InChI=1S/C5H13NO3/c1-3(7)4(8)2-5(6)9/h3-5,7-9H,2,6H2,1H3 |
| InChIKey | PLTNDGHQCWFEHQ-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.16 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-aminopentane-1,3,4-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopentane-1,3,4-triol?
The IUPAC name of 1-aminopentane-1,3,4-triol (CID 123407087) is 1-aminopentane-1,3,4-triol.
What is the SMILES notation for 1-aminopentane-1,3,4-triol?
The canonical SMILES for 1-aminopentane-1,3,4-triol is CC(O)C(O)CC(N)O.
What is the InChIKey of 1-aminopentane-1,3,4-triol?
The InChIKey is PLTNDGHQCWFEHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO3/c1-3(7)4(8)2-5(6)9/h3-5,7-9H,2,6H2,1H3.
What are the key properties of 1-aminopentane-1,3,4-triol?
1-aminopentane-1,3,4-triol has a molecular weight of 135.16 g/mol, XLogP of -1.60, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopentane-1,3,4-triol is sourced from PubChem (CID 123407087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).