C15H16N2O5 — CID 123407143
8-(4-methoxyphenyl)imino-2,3,5,8a-tetrahydropyrano[4,3-b][1,4]oxazine-3-carboxylic acid (PubChem CID 123407143) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is 8-(4-methoxyphenyl)imino-2,3,5,8a-tetrahydropyrano[4,3-b][1,4]oxazine-3-carboxylic acid.
| Compound Name | 8-(4-methoxyphenyl)imino-2,3,5,8a-tetrahydropyrano[4,3-b][1,4]oxazine-3-carboxylic acid |
|---|---|
| PubChem CID | 123407143 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 8-(4-methoxyphenyl)imino-2,3,5,8a-tetrahydropyrano[4,3-b][1,4]oxazine-3-carboxylic acid |
| SMILES | COc1ccc(/N=C2\COCC3=NC(C(=O)O)COC32)cc1 |
| InChI | InChI=1S/C15H16N2O5/c1-20-10-4-2-9(3-5-10)16-11-6-21-7-12-14(11)22-8-13(17-12)15(18)19/h2-5,13-14H,6-8H2,1H3,(H,18,19)/b16-11+ |
| InChIKey | SYTYOGKPBGGREE-LFIBNONCSA-N |
| XLogP | 1.09 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|