About N,4-dimethyl-2-(trifluoromethyl)penta-2,4-dien-1-imine
N,4-dimethyl-2-(trifluoromethyl)penta-2,4-dien-1-imine (PubChem CID 123408100) has the molecular formula C8H10F3N
and a molecular weight of 177.17 g/mol. Its IUPAC name is N,4-dimethyl-2-(trifluoromethyl)penta-2,4-dien-1-imine.
Molecular Properties
| Compound Name | N,4-dimethyl-2-(trifluoromethyl)penta-2,4-dien-1-imine |
| PubChem CID | 123408100 |
| Molecular Formula | C8H10F3N |
| Molecular Weight | 177.17 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | N,4-dimethyl-2-(trifluoromethyl)penta-2,4-dien-1-imine |
| SMILES | C=C(C)C=C(/C=N/C)C(F)(F)F |
| InChI | InChI=1S/C8H10F3N/c1-6(2)4-7(5-12-3)8(9,10)11/h4-5H,1H2,2-3H3/b7-4?,12-5+ |
| InChIKey | ZTGNEDMJFNJDFS-PXDAUENDSA-N |
| XLogP | 2.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.17 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N,4-dimethyl-2-(trifluoromethyl)penta-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-dimethyl-2-(trifluoromethyl)penta-2,4-dien-1-imine?
The IUPAC name of N,4-dimethyl-2-(trifluoromethyl)penta-2,4-dien-1-imine (CID 123408100) is N,4-dimethyl-2-(trifluoromethyl)penta-2,4-dien-1-imine.
What is the SMILES notation for N,4-dimethyl-2-(trifluoromethyl)penta-2,4-dien-1-imine?
The canonical SMILES for N,4-dimethyl-2-(trifluoromethyl)penta-2,4-dien-1-imine is C=C(C)C=C(/C=N/C)C(F)(F)F.
What is the InChIKey of N,4-dimethyl-2-(trifluoromethyl)penta-2,4-dien-1-imine?
The InChIKey is ZTGNEDMJFNJDFS-PXDAUENDSA-N. The full InChI is InChI=1S/C8H10F3N/c1-6(2)4-7(5-12-3)8(9,10)11/h4-5H,1H2,2-3H3/b7-4?,12-5+.
What are the key properties of N,4-dimethyl-2-(trifluoromethyl)penta-2,4-dien-1-imine?
N,4-dimethyl-2-(trifluoromethyl)penta-2,4-dien-1-imine has a molecular weight of 177.17 g/mol, XLogP of 2.75, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-dimethyl-2-(trifluoromethyl)penta-2,4-dien-1-imine is sourced from PubChem (CID 123408100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).