C24H31BrN4O2S — CID 123408299
N-[3-[[2-bromo-1-(5-methylsulfanyl-2-pyridinyl)propylidene]amino]oxy-2,2-dimethylpropoxy]-2-methyl-6,7-dihydro-5H-quinolin-8-imine (PubChem CID 123408299) has the molecular formula C24H31BrN4O2S and a molecular weight of 519.51 g/mol. Its IUPAC name is N-[3-[[2-bromo-1-(5-methylsulfanyl-2-pyridinyl)propylidene]amino]oxy-2,2-dimethylpropoxy]-2-methyl-6,7-dihydro-5H-quinolin-8-imine.
| Compound Name | N-[3-[[2-bromo-1-(5-methylsulfanyl-2-pyridinyl)propylidene]amino]oxy-2,2-dimethylpropoxy]-2-methyl-6,7-dihydro-5H-quinolin-8-imine |
|---|---|
| PubChem CID | 123408299 |
| Molecular Formula | C24H31BrN4O2S |
| Molecular Weight | 519.51 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | N-[3-[[2-bromo-1-(5-methylsulfanyl-2-pyridinyl)propylidene]amino]oxy-2,2-dimethylpropoxy]-2-methyl-6,7-dihydro-5H-quinolin-8-imine |
| SMILES | CSc1ccc(C(=NOCC(C)(C)CON=C2CCCc3ccc(C)nc32)C(C)Br)nc1 |
| InChI | InChI=1S/C24H31BrN4O2S/c1-16-9-10-18-7-6-8-21(23(18)27-16)28-30-14-24(3,4)15-31-29-22(17(2)25)20-12-11-19(32-5)13-26-20/h9-13,17H,6-8,14-15H2,1-5H3 |
| InChIKey | ONPARNONGBYSQL-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.51 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|