C25H36N4O2 — CID 123408468
N-cyclohexyl-3-ethenyl-2-[(2-imidazol-1-ylacetyl)-(2-methylpenta-2,4-dienyl)amino]-4-methylpent-3-enamide (PubChem CID 123408468) has the molecular formula C25H36N4O2 and a molecular weight of 424.59 g/mol. Its IUPAC name is N-cyclohexyl-3-ethenyl-2-[(2-imidazol-1-ylacetyl)-(2-methylpenta-2,4-dienyl)amino]-4-methylpent-3-enamide.
| Compound Name | N-cyclohexyl-3-ethenyl-2-[(2-imidazol-1-ylacetyl)-(2-methylpenta-2,4-dienyl)amino]-4-methylpent-3-enamide |
|---|---|
| PubChem CID | 123408468 |
| Molecular Formula | C25H36N4O2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | N-cyclohexyl-3-ethenyl-2-[(2-imidazol-1-ylacetyl)-(2-methylpenta-2,4-dienyl)amino]-4-methylpent-3-enamide |
| SMILES | C=CC=C(C)CN(C(=O)Cn1ccnc1)C(C(=O)NC1CCCCC1)C(C=C)=C(C)C |
| InChI | InChI=1S/C25H36N4O2/c1-6-11-20(5)16-29(23(30)17-28-15-14-26-18-28)24(22(7-2)19(3)4)25(31)27-21-12-9-8-10-13-21/h6-7,11,14-15,18,21,24H,1-2,8-10,12-13,16-17H2,3-5H3,(H,27,31) |
| InChIKey | RDNYQQRRIYDMGK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|