C7H10N2 — CID 123408800
3a,4,5,6-tetrahydro-3H-indazole (PubChem CID 123408800) has the molecular formula C7H10N2 and a molecular weight of 122.17 g/mol. Its IUPAC name is 3a,4,5,6-tetrahydro-3H-indazole.
| Compound Name | 3a,4,5,6-tetrahydro-3H-indazole |
|---|---|
| PubChem CID | 123408800 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 3a,4,5,6-tetrahydro-3H-indazole |
| SMILES | C1=C2N=NCC2CCC1 |
| InChI | InChI=1S/C7H10N2/c1-2-4-7-6(3-1)5-8-9-7/h4,6H,1-3,5H2 |
| InChIKey | DLJGYGPIIQFCLD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |