C25H36N4O2 — CID 123408826
[4-(2-methylhexa-2,4-dien-3-yl)piperidin-1-yl]-(6-methyl-9-morpholin-4-yl-2H-1,5-diazonin-4-yl)methanone (PubChem CID 123408826) has the molecular formula C25H36N4O2 and a molecular weight of 424.59 g/mol. Its IUPAC name is [4-(2-methylhexa-2,4-dien-3-yl)piperidin-1-yl]-(6-methyl-9-morpholin-4-yl-2H-1,5-diazonin-4-yl)methanone.
| Compound Name | [4-(2-methylhexa-2,4-dien-3-yl)piperidin-1-yl]-(6-methyl-9-morpholin-4-yl-2H-1,5-diazonin-4-yl)methanone |
|---|---|
| PubChem CID | 123408826 |
| Molecular Formula | C25H36N4O2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | [4-(2-methylhexa-2,4-dien-3-yl)piperidin-1-yl]-(6-methyl-9-morpholin-4-yl-2H-1,5-diazonin-4-yl)methanone |
| SMILES | CC=CC(=C(C)C)C1CCN(C(=O)C2=CC/N=C(/N3CCOCC3)C=C/C(C)=N\2)CC1 |
| InChI | InChI=1S/C25H36N4O2/c1-5-6-22(19(2)3)21-10-13-29(14-11-21)25(30)23-9-12-26-24(8-7-20(4)27-23)28-15-17-31-18-16-28/h5-9,21H,10-18H2,1-4H3/b6-5?,8-7?,23-9?,26-24+,27-20- |
| InChIKey | UVKIKHSMHRNFGI-PFGBSMEDSA-N |
| XLogP | 3.78 |
| TPSA | 57.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|