C17H33N2+ — CID 123409113
3-(cyclobutylmethyl)-2,4-diethyl-4-propan-2-yl-1,2,3,7-tetrahydro-1,4-diazepin-4-ium (PubChem CID 123409113) has the molecular formula C17H33N2+ and a molecular weight of 265.46 g/mol. Its IUPAC name is 3-(cyclobutylmethyl)-2,4-diethyl-4-propan-2-yl-1,2,3,7-tetrahydro-1,4-diazepin-4-ium.
| Compound Name | 3-(cyclobutylmethyl)-2,4-diethyl-4-propan-2-yl-1,2,3,7-tetrahydro-1,4-diazepin-4-ium |
|---|---|
| PubChem CID | 123409113 |
| Molecular Formula | C17H33N2+ |
| Molecular Weight | 265.46 g/mol |
| Exact Mass | 265.26 |
| IUPAC Name | 3-(cyclobutylmethyl)-2,4-diethyl-4-propan-2-yl-1,2,3,7-tetrahydro-1,4-diazepin-4-ium |
| SMILES | CCC1NCC=C[N+](CC)(C(C)C)C1CC1CCC1 |
| InChI | InChI=1S/C17H33N2/c1-5-16-17(13-15-9-7-10-15)19(6-2,14(3)4)12-8-11-18-16/h8,12,14-18H,5-7,9-11,13H2,1-4H3/q+1 |
| InChIKey | WBSRWHDPWFBFRO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|