About (1-amino-4-bromo-9,10-dioxoanthracen-2-yl)sulfonyl-cyclopropyl-oxoazanium
(1-amino-4-bromo-9,10-dioxoanthracen-2-yl)sulfonyl-cyclopropyl-oxoazanium (PubChem CID 123409546) has the molecular formula C17H12BrN2O5S+
and a molecular weight of 436.26 g/mol. Its IUPAC name is (1-amino-4-bromo-9,10-dioxoanthracen-2-yl)sulfonyl-cyclopropyl-oxoazanium.
Molecular Properties
| Compound Name | (1-amino-4-bromo-9,10-dioxoanthracen-2-yl)sulfonyl-cyclopropyl-oxoazanium |
| PubChem CID | 123409546 |
| Molecular Formula | C17H12BrN2O5S+ |
| Molecular Weight | 436.26 g/mol |
| Exact Mass | 434.96 |
| IUPAC Name | (1-amino-4-bromo-9,10-dioxoanthracen-2-yl)sulfonyl-cyclopropyl-oxoazanium |
| SMILES | Nc1c(S(=O)(=O)[N+](=O)C2CC2)cc(Br)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H11BrN2O5S/c18-11-7-12(26(24,25)20(23)8-5-6-8)15(19)14-13(11)16(21)9-3-1-2-4-10(9)17(14)22/h1-4,7-8H,5-6H2,(H-,19,22)/p+1 |
| InChIKey | HQVSYWQSXBDAHB-UHFFFAOYSA-O |
| XLogP | 2.44 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (1-amino-4-bromo-9,10-dioxoanthracen-2-yl)sulfonyl-cyclopropyl-oxoazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-amino-4-bromo-9,10-dioxoanthracen-2-yl)sulfonyl-cyclopropyl-oxoazanium?
The IUPAC name of (1-amino-4-bromo-9,10-dioxoanthracen-2-yl)sulfonyl-cyclopropyl-oxoazanium (CID 123409546) is (1-amino-4-bromo-9,10-dioxoanthracen-2-yl)sulfonyl-cyclopropyl-oxoazanium.
What is the SMILES notation for (1-amino-4-bromo-9,10-dioxoanthracen-2-yl)sulfonyl-cyclopropyl-oxoazanium?
The canonical SMILES for (1-amino-4-bromo-9,10-dioxoanthracen-2-yl)sulfonyl-cyclopropyl-oxoazanium is Nc1c(S(=O)(=O)[N+](=O)C2CC2)cc(Br)c2c1C(=O)c1ccccc1C2=O.
What is the InChIKey of (1-amino-4-bromo-9,10-dioxoanthracen-2-yl)sulfonyl-cyclopropyl-oxoazanium?
The InChIKey is HQVSYWQSXBDAHB-UHFFFAOYSA-O. The full InChI is InChI=1S/C17H11BrN2O5S/c18-11-7-12(26(24,25)20(23)8-5-6-8)15(19)14-13(11)16(21)9-3-1-2-4-10(9)17(14)22/h1-4,7-8H,5-6H2,(H-,19,22)/p+1.
What are the key properties of (1-amino-4-bromo-9,10-dioxoanthracen-2-yl)sulfonyl-cyclopropyl-oxoazanium?
(1-amino-4-bromo-9,10-dioxoanthracen-2-yl)sulfonyl-cyclopropyl-oxoazanium has a molecular weight of 436.26 g/mol, XLogP of 2.44, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-amino-4-bromo-9,10-dioxoanthracen-2-yl)sulfonyl-cyclopropyl-oxoazanium is sourced from PubChem (CID 123409546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).