C17H25N4+ — CID 123409904
4-tert-butyl-9-ethyl-9-methyl-3,5,6-triaza-10-azoniatricyclo[8.4.0.02,6]tetradeca-1(14),2,4,10,12-pentaene (PubChem CID 123409904) has the molecular formula C17H25N4+ and a molecular weight of 285.42 g/mol. Its IUPAC name is 4-tert-butyl-9-ethyl-9-methyl-3,5,6-triaza-10-azoniatricyclo[8.4.0.02,6]tetradeca-1(14),2,4,10,12-pentaene.
| Compound Name | 4-tert-butyl-9-ethyl-9-methyl-3,5,6-triaza-10-azoniatricyclo[8.4.0.02,6]tetradeca-1(14),2,4,10,12-pentaene |
|---|---|
| PubChem CID | 123409904 |
| Molecular Formula | C17H25N4+ |
| Molecular Weight | 285.42 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 4-tert-butyl-9-ethyl-9-methyl-3,5,6-triaza-10-azoniatricyclo[8.4.0.02,6]tetradeca-1(14),2,4,10,12-pentaene |
| SMILES | CCC1(C)CCn2nc(C(C)(C)C)nc2-c2cccc[n+]21 |
| InChI | InChI=1S/C17H25N4/c1-6-17(5)10-12-21-14(13-9-7-8-11-20(13)17)18-15(19-21)16(2,3)4/h7-9,11H,6,10,12H2,1-5H3/q+1 |
| InChIKey | ALUVWQYZRIAODQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|